C18H22BrFN2OS — CID 24750422
5-bromo-2-[2-[(dimethylamino)methyl]-4-(3-fluoropropoxy)phenyl]sulfanylaniline (PubChem CID 24750422) has the molecular formula C18H22BrFN2OS and a molecular weight of 413.36 g/mol. Its IUPAC name is 5-bromo-2-[2-[(dimethylamino)methyl]-4-(3-fluoropropoxy)phenyl]sulfanylaniline.
| Compound Name | 5-bromo-2-[2-[(dimethylamino)methyl]-4-(3-fluoropropoxy)phenyl]sulfanylaniline |
|---|---|
| PubChem CID | 24750422 |
| Molecular Formula | C18H22BrFN2OS |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 5-bromo-2-[2-[(dimethylamino)methyl]-4-(3-fluoropropoxy)phenyl]sulfanylaniline |
| SMILES | CN(C)Cc1cc(OCCCF)ccc1Sc1ccc(Br)cc1N |
| InChI | InChI=1S/C18H22BrFN2OS/c1-22(2)12-13-10-15(23-9-3-8-20)5-7-17(13)24-18-6-4-14(19)11-16(18)21/h4-7,10-11H,3,8-9,12,21H2,1-2H3 |
| InChIKey | QLIVPGJLVJVMJT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|