C17H21FN2OS — CID 24748883
2-[2-[(dimethylamino)methyl]-4-(2-(18F)fluoroethoxy)phenyl]sulfanyl(18F)aniline (PubChem CID 24748883) has the molecular formula C17H21FN2OS and a molecular weight of 319.44 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]-4-(2-(18F)fluoroethoxy)phenyl]sulfanyl(18F)aniline.
| Compound Name | 2-[2-[(dimethylamino)methyl]-4-(2-(18F)fluoroethoxy)phenyl]sulfanyl(18F)aniline |
|---|---|
| PubChem CID | 24748883 |
| Molecular Formula | C17H21FN2OS |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]-4-(2-(18F)fluoroethoxy)phenyl]sulfanyl(18F)aniline |
| SMILES | CN(C)Cc1cc(OCC[18F])ccc1Sc1ccccc1N |
| InChI | InChI=1S/C17H21FN2OS/c1-20(2)12-13-11-14(21-10-9-18)7-8-16(13)22-17-6-4-3-5-15(17)19/h3-8,11H,9-10,12,19H2,1-2H3/i18-1 |
| InChIKey | PWAQSKSFOYUNMV-SQZVAGKESA-N |
| XLogP | 3.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|