About 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one
1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one (PubChem CID 145412253) has the molecular formula C13H12N4OS
and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one.
Molecular Properties
| Compound Name | 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one |
| PubChem CID | 145412253 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one |
| SMILES | C=Nc1c(N=C)n(Cc2ccccc2)c(=S)[nH]c1=O |
| InChI | InChI=1S/C13H12N4OS/c1-14-10-11(15-2)17(13(19)16-12(10)18)8-9-6-4-3-5-7-9/h3-7H,1-2,8H2,(H,16,18,19) |
| InChIKey | SMSNWGPALOSHML-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one?
The IUPAC name of 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one (CID 145412253) is 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one.
What is the SMILES notation for 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one?
The canonical SMILES for 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one is C=Nc1c(N=C)n(Cc2ccccc2)c(=S)[nH]c1=O.
What is the InChIKey of 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one?
The InChIKey is SMSNWGPALOSHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4OS/c1-14-10-11(15-2)17(13(19)16-12(10)18)8-9-6-4-3-5-7-9/h3-7H,1-2,8H2,(H,16,18,19).
What are the key properties of 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one?
1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one has a molecular weight of 272.33 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5,6-bis(methylideneamino)-2-sulfanylidenepyrimidin-4-one is sourced from PubChem (CID 145412253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).