About (3-methyl-2-pyridinyl) thiohypofluorite
(3-methyl-2-pyridinyl) thiohypofluorite (PubChem CID 145413096) has the molecular formula C6H6FNS
and a molecular weight of 143.19 g/mol. Its IUPAC name is (3-methyl-2-pyridinyl) thiohypofluorite.
Molecular Properties
| Compound Name | (3-methyl-2-pyridinyl) thiohypofluorite |
| PubChem CID | 145413096 |
| Molecular Formula | C6H6FNS |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | (3-methyl-2-pyridinyl) thiohypofluorite |
| SMILES | Cc1cccnc1SF |
| InChI | InChI=1S/C6H6FNS/c1-5-3-2-4-8-6(5)9-7/h2-4H,1H3 |
| InChIKey | CHGAYQJGQBQRTO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methyl-2-pyridinyl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2-pyridinyl) thiohypofluorite?
The IUPAC name of (3-methyl-2-pyridinyl) thiohypofluorite (CID 145413096) is (3-methyl-2-pyridinyl) thiohypofluorite.
What is the SMILES notation for (3-methyl-2-pyridinyl) thiohypofluorite?
The canonical SMILES for (3-methyl-2-pyridinyl) thiohypofluorite is Cc1cccnc1SF.
What is the InChIKey of (3-methyl-2-pyridinyl) thiohypofluorite?
The InChIKey is CHGAYQJGQBQRTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNS/c1-5-3-2-4-8-6(5)9-7/h2-4H,1H3.
What are the key properties of (3-methyl-2-pyridinyl) thiohypofluorite?
(3-methyl-2-pyridinyl) thiohypofluorite has a molecular weight of 143.19 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2-pyridinyl) thiohypofluorite is sourced from PubChem (CID 145413096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).