C11H25BO2 — CID 145413158
ethane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane (PubChem CID 145413158) has the molecular formula C11H25BO2 and a molecular weight of 200.13 g/mol. Its IUPAC name is ethane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane.
| Compound Name | ethane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 145413158 |
| Molecular Formula | C11H25BO2 |
| Molecular Weight | 200.13 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | ethane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
| SMILES | CC.CC1CC(C)(C)OB(C(C)C)O1 |
| InChI | InChI=1S/C9H19BO2.C2H6/c1-7(2)10-11-8(3)6-9(4,5)12-10;1-2/h7-8H,6H2,1-5H3;1-2H3 |
| InChIKey | GZLKJAHJQSSFED-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.13 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|