C17H30IN3O4 — CID 145413276
[[3-(3-methylpentanoylamino)-1λ3-iodetane-1-carbonyl]amino]methyl piperidine-4-carboxylate (PubChem CID 145413276) has the molecular formula C17H30IN3O4 and a molecular weight of 467.35 g/mol. Its IUPAC name is [[3-(3-methylpentanoylamino)-1λ3-iodetane-1-carbonyl]amino]methyl piperidine-4-carboxylate.
| Compound Name | [[3-(3-methylpentanoylamino)-1λ3-iodetane-1-carbonyl]amino]methyl piperidine-4-carboxylate |
|---|---|
| PubChem CID | 145413276 |
| Molecular Formula | C17H30IN3O4 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | [[3-(3-methylpentanoylamino)-1λ3-iodetane-1-carbonyl]amino]methyl piperidine-4-carboxylate |
| SMILES | CCC(C)CC(=O)NC1CI(C(=O)NCOC(=O)C2CCNCC2)C1 |
| InChI | InChI=1S/C17H30IN3O4/c1-3-12(2)8-15(22)21-14-9-18(10-14)17(24)20-11-25-16(23)13-4-6-19-7-5-13/h12-14,19H,3-11H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | JTNHZWVDTOADGT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|