C11H14F2N2O — CID 145415333
4-(difluoromethyl)-3-(1-methylpyrrolidin-3-yl)oxypyridine (PubChem CID 145415333) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-(1-methylpyrrolidin-3-yl)oxypyridine.
| Compound Name | 4-(difluoromethyl)-3-(1-methylpyrrolidin-3-yl)oxypyridine |
|---|---|
| PubChem CID | 145415333 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-(difluoromethyl)-3-(1-methylpyrrolidin-3-yl)oxypyridine |
| SMILES | CN1CCC(Oc2cnccc2C(F)F)C1 |
| InChI | InChI=1S/C11H14F2N2O/c1-15-5-3-8(7-15)16-10-6-14-4-2-9(10)11(12)13/h2,4,6,8,11H,3,5,7H2,1H3 |
| InChIKey | KTYBPJXPVVGLCS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |