C36H36ClF3N2O5 — CID 145417707
3-[[4-[1-[4-(4-chloro-2-methylphenyl)phenyl]-1-[4-(trifluoromethoxy)phenyl]pentan-2-yl]benzoyl]amino]propanoic acid;formamide (PubChem CID 145417707) has the molecular formula C36H36ClF3N2O5 and a molecular weight of 669.14 g/mol. Its IUPAC name is 3-[[4-[1-[4-(4-chloro-2-methylphenyl)phenyl]-1-[4-(trifluoromethoxy)phenyl]pentan-2-yl]benzoyl]amino]propanoic acid;formamide.
| Compound Name | 3-[[4-[1-[4-(4-chloro-2-methylphenyl)phenyl]-1-[4-(trifluoromethoxy)phenyl]pentan-2-yl]benzoyl]amino]propanoic acid;formamide |
|---|---|
| PubChem CID | 145417707 |
| Molecular Formula | C36H36ClF3N2O5 |
| Molecular Weight | 669.14 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | 3-[[4-[1-[4-(4-chloro-2-methylphenyl)phenyl]-1-[4-(trifluoromethoxy)phenyl]pentan-2-yl]benzoyl]amino]propanoic acid;formamide |
| SMILES | CCCC(c1ccc(C(=O)NCCC(=O)O)cc1)C(c1ccc(OC(F)(F)F)cc1)c1ccc(-c2ccc(Cl)cc2C)cc1.NC=O |
| InChI | InChI=1S/C35H33ClF3NO4.CH3NO/c1-3-4-31(24-7-11-27(12-8-24)34(43)40-20-19-32(41)42)33(26-13-16-29(17-14-26)44-35(37,38)39)25-9-5-23(6-10-25)30-18-15-28(36)21-22(30)2;2-1-3/h5-18,21,31,33H,3-4,19-20H2,1-2H3,(H,40,43)(H,41,42);1H,(H2,2,3) |
| InChIKey | VJQYAEMKTLEGIL-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.14 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|