C30H30F6N2O5 — CID 145417697
3-[[4-[(2S,3R)-1-[(2,4,6-trifluoroanilino)methoxy]-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzoyl]amino]propanoic acid (PubChem CID 145417697) has the molecular formula C30H30F6N2O5 and a molecular weight of 612.57 g/mol. Its IUPAC name is 3-[[4-[(2S,3R)-1-[(2,4,6-trifluoroanilino)methoxy]-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(2S,3R)-1-[(2,4,6-trifluoroanilino)methoxy]-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 145417697 |
| Molecular Formula | C30H30F6N2O5 |
| Molecular Weight | 612.57 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 3-[[4-[(2S,3R)-1-[(2,4,6-trifluoroanilino)methoxy]-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzoyl]amino]propanoic acid |
| SMILES | CCC[C@@H](c1ccc(C(=O)NCCC(=O)O)cc1)[C@H](COCNc1c(F)cc(F)cc1F)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C30H30F6N2O5/c1-2-3-23(18-4-6-20(7-5-18)29(41)37-13-12-27(39)40)24(19-8-10-22(11-9-19)43-30(34,35)36)16-42-17-38-28-25(32)14-21(31)15-26(28)33/h4-11,14-15,23-24,38H,2-3,12-13,16-17H2,1H3,(H,37,41)(H,39,40)/t23-,24+/m0/s1 |
| InChIKey | RCIXQEKKEZOGKU-BJKOFHAPSA-N |
| XLogP | 6.96 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|