C38H41F4N3O5 — CID 147739396
3-[[4-[(1S,2R)-1-[[2-fluoro-4-(2,4,6-trimethylcyclohexa-2,4-dien-1-yl)phenyl]carbamoylamino]-1-[4-(trifluoromethoxy)phenyl]pentan-2-yl]benzoyl]amino]propanoic acid (PubChem CID 147739396) has the molecular formula C38H41F4N3O5 and a molecular weight of 695.75 g/mol. Its IUPAC name is 3-[[4-[(1S,2R)-1-[[2-fluoro-4-(2,4,6-trimethylcyclohexa-2,4-dien-1-yl)phenyl]carbamoylamino]-1-[4-(trifluoromethoxy)phenyl]pentan-2-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(1S,2R)-1-[[2-fluoro-4-(2,4,6-trimethylcyclohexa-2,4-dien-1-yl)phenyl]carbamoylamino]-1-[4-(trifluoromethoxy)phenyl]pentan-2-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 147739396 |
| Molecular Formula | C38H41F4N3O5 |
| Molecular Weight | 695.75 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 3-[[4-[(1S,2R)-1-[[2-fluoro-4-(2,4,6-trimethylcyclohexa-2,4-dien-1-yl)phenyl]carbamoylamino]-1-[4-(trifluoromethoxy)phenyl]pentan-2-yl]benzoyl]amino]propanoic acid |
| SMILES | CCC[C@H](c1ccc(C(=O)NCCC(=O)O)cc1)[C@H](NC(=O)Nc1ccc(C2C(C)=CC(C)=CC2C)cc1F)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C38H41F4N3O5/c1-5-6-30(25-7-9-27(10-8-25)36(48)43-18-17-33(46)47)35(26-11-14-29(15-12-26)50-38(40,41)42)45-37(49)44-32-16-13-28(21-31(32)39)34-23(3)19-22(2)20-24(34)4/h7-16,19-21,23,30,34-35H,5-6,17-18H2,1-4H3,(H,43,48)(H,46,47)(H2,44,45,49)/t23?,30-,34?,35-/m1/s1 |
| InChIKey | GZZZUMNJOOKFSS-MDYDPOOHSA-N |
| XLogP | 9.00 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.75 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |