C23H33ClF2N6S2 — CID 145418506
3-(3-amino-2-chlorophenyl)sulfanyl-6-(3,3-difluoro-8-azaspiro[4.5]decan-8-yl)pyrazin-2-amine;S-tert-butylthiohydroxylamine (PubChem CID 145418506) has the molecular formula C23H33ClF2N6S2 and a molecular weight of 531.14 g/mol. Its IUPAC name is 3-(3-amino-2-chlorophenyl)sulfanyl-6-(3,3-difluoro-8-azaspiro[4.5]decan-8-yl)pyrazin-2-amine;S-tert-butylthiohydroxylamine.
| Compound Name | 3-(3-amino-2-chlorophenyl)sulfanyl-6-(3,3-difluoro-8-azaspiro[4.5]decan-8-yl)pyrazin-2-amine;S-tert-butylthiohydroxylamine |
|---|---|
| PubChem CID | 145418506 |
| Molecular Formula | C23H33ClF2N6S2 |
| Molecular Weight | 531.14 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 3-(3-amino-2-chlorophenyl)sulfanyl-6-(3,3-difluoro-8-azaspiro[4.5]decan-8-yl)pyrazin-2-amine;S-tert-butylthiohydroxylamine |
| SMILES | CC(C)(C)SN.Nc1cccc(Sc2ncc(N3CCC4(CC3)CCC(F)(F)C4)nc2N)c1Cl |
| InChI | InChI=1S/C19H22ClF2N5S.C4H11NS/c20-15-12(23)2-1-3-13(15)28-17-16(24)26-14(10-25-17)27-8-6-18(7-9-27)4-5-19(21,22)11-18;1-4(2,3)6-5/h1-3,10H,4-9,11,23H2,(H2,24,26);5H2,1-3H3 |
| InChIKey | MJXJHTUOEKLJPA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.14 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|