C15H33NO2 — CID 145419006
2-tert-butyl-4,4-dimethylpentanal;2-methoxy-N-methylethanamine (PubChem CID 145419006) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is 2-tert-butyl-4,4-dimethylpentanal;2-methoxy-N-methylethanamine.
| Compound Name | 2-tert-butyl-4,4-dimethylpentanal;2-methoxy-N-methylethanamine |
|---|---|
| PubChem CID | 145419006 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 2-tert-butyl-4,4-dimethylpentanal;2-methoxy-N-methylethanamine |
| SMILES | CC(C)(C)CC(C=O)C(C)(C)C.CNCCOC |
| InChI | InChI=1S/C11H22O.C4H11NO/c1-10(2,3)7-9(8-12)11(4,5)6;1-5-3-4-6-2/h8-9H,7H2,1-6H3;5H,3-4H2,1-2H3 |
| InChIKey | YBVHUERGZCDGMD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|