C10H23N3O3 — CID 144998233
2-methoxy-N-methylethanamine;1-methyl-1-(2-methyl-1-oxopropan-2-yl)urea (PubChem CID 144998233) has the molecular formula C10H23N3O3 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-methoxy-N-methylethanamine;1-methyl-1-(2-methyl-1-oxopropan-2-yl)urea.
| Compound Name | 2-methoxy-N-methylethanamine;1-methyl-1-(2-methyl-1-oxopropan-2-yl)urea |
|---|---|
| PubChem CID | 144998233 |
| Molecular Formula | C10H23N3O3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | 2-methoxy-N-methylethanamine;1-methyl-1-(2-methyl-1-oxopropan-2-yl)urea |
| SMILES | CN(C(N)=O)C(C)(C)C=O.CNCCOC |
| InChI | InChI=1S/C6H12N2O2.C4H11NO/c1-6(2,4-9)8(3)5(7)10;1-5-3-4-6-2/h4H,1-3H3,(H2,7,10);5H,3-4H2,1-2H3 |
| InChIKey | ZYIIWTJCWHKFIU-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|