About ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid
ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid (PubChem CID 145419435) has the molecular formula C17H21FN2O4
and a molecular weight of 336.36 g/mol. Its IUPAC name is ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid |
| PubChem CID | 145419435 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid |
| SMILES | CC.CCc1cc(C(=O)O)ccn1.Cc1ncc(C(=O)O)cc1F |
| InChI | InChI=1S/C8H9NO2.C7H6FNO2.C2H6/c1-2-7-5-6(8(10)11)3-4-9-7;1-4-6(8)2-5(3-9-4)7(10)11;1-2/h3-5H,2H2,1H3,(H,10,11);2-3H,1H3,(H,10,11);1-2H3 |
| InChIKey | TTYKVJHKNFMGNF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid?
The IUPAC name of ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid (CID 145419435) is ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid.
What is the SMILES notation for ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid?
The canonical SMILES for ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid is CC.CCc1cc(C(=O)O)ccn1.Cc1ncc(C(=O)O)cc1F.
What is the InChIKey of ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid?
The InChIKey is TTYKVJHKNFMGNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C7H6FNO2.C2H6/c1-2-7-5-6(8(10)11)3-4-9-7;1-4-6(8)2-5(3-9-4)7(10)11;1-2/h3-5H,2H2,1H3,(H,10,11);2-3H,1H3,(H,10,11);1-2H3.
What are the key properties of ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid?
ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid has a molecular weight of 336.36 g/mol, XLogP of 3.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylpyridine-4-carboxylic acid;5-fluoro-6-methylpyridine-3-carboxylic acid is sourced from PubChem (CID 145419435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).