C29H40N2O8 — CID 145420742
ethane;4-hydroxy-13-(hydroxymethyl)-21-methoxy-22-(methoxymethoxy)-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-6,11,18(23),19,21-pentaen-5-one (PubChem CID 145420742) has the molecular formula C29H40N2O8 and a molecular weight of 544.65 g/mol. Its IUPAC name is ethane;4-hydroxy-13-(hydroxymethyl)-21-methoxy-22-(methoxymethoxy)-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-6,11,18(23),19,21-pentaen-5-one.
| Compound Name | ethane;4-hydroxy-13-(hydroxymethyl)-21-methoxy-22-(methoxymethoxy)-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-6,11,18(23),19,21-pentaen-5-one |
|---|---|
| PubChem CID | 145420742 |
| Molecular Formula | C29H40N2O8 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | ethane;4-hydroxy-13-(hydroxymethyl)-21-methoxy-22-(methoxymethoxy)-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-6,11,18(23),19,21-pentaen-5-one |
| SMILES | CC.COCOc1c(OC)c(C)cc2c1C1C3CC4(O)C(=O)C(C)=C5OCOC5=C4C(CO)N3CC(C2)N1C |
| InChI | InChI=1S/C27H34N2O8.C2H6/c1-13-6-15-7-16-9-29-17(21(28(16)3)19(15)24(22(13)34-5)35-11-33-4)8-27(32)20(18(29)10-30)25-23(36-12-37-25)14(2)26(27)31;1-2/h6,16-18,21,30,32H,7-12H2,1-5H3;1-2H3 |
| InChIKey | ZSCXMEWHRUSEGF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|