C35H42N4O4 — CID 145422619
(2S)-N-(4-amino-4-oxo-1-phenylbutan-2-yl)-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]pyrrolidine-2-carboxamide (PubChem CID 145422619) has the molecular formula C35H42N4O4 and a molecular weight of 582.75 g/mol. Its IUPAC name is (2S)-N-(4-amino-4-oxo-1-phenylbutan-2-yl)-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-amino-4-oxo-1-phenylbutan-2-yl)-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 145422619 |
| Molecular Formula | C35H42N4O4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | (2S)-N-(4-amino-4-oxo-1-phenylbutan-2-yl)-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)CC(Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](CC1CCCCC1)NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H42N4O4/c36-32(40)23-29(20-24-10-3-1-4-11-24)37-34(42)31-16-9-19-39(31)35(43)30(21-25-12-5-2-6-13-25)38-33(41)28-18-17-26-14-7-8-15-27(26)22-28/h1,3-4,7-8,10-11,14-15,17-18,22,25,29-31H,2,5-6,9,12-13,16,19-21,23H2,(H2,36,40)(H,37,42)(H,38,41)/t29?,30-,31+/m1/s1 |
| InChIKey | FUBYBWAOUVBSIL-DEDDTWKVSA-N |
| XLogP | 4.50 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |