C38H49BN4O6 — CID 145107300
[(1R)-1-[[(2S,4S)-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-4-(3-phenylpropanoylamino)pyrrolidine-2-carbonyl]amino]-2-methylpropyl]boronic acid (PubChem CID 145107300) has the molecular formula C38H49BN4O6 and a molecular weight of 668.64 g/mol. Its IUPAC name is [(1R)-1-[[(2S,4S)-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-4-(3-phenylpropanoylamino)pyrrolidine-2-carbonyl]amino]-2-methylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S,4S)-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-4-(3-phenylpropanoylamino)pyrrolidine-2-carbonyl]amino]-2-methylpropyl]boronic acid |
|---|---|
| PubChem CID | 145107300 |
| Molecular Formula | C38H49BN4O6 |
| Molecular Weight | 668.64 g/mol |
| Exact Mass | 668.37 |
| IUPAC Name | [(1R)-1-[[(2S,4S)-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-4-(3-phenylpropanoylamino)pyrrolidine-2-carbonyl]amino]-2-methylpropyl]boronic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H]1C[C@H](NC(=O)CCc2ccccc2)CN1C(=O)[C@@H](CC1CCCCC1)NC(=O)c1ccc2ccccc2c1)B(O)O |
| InChI | InChI=1S/C38H49BN4O6/c1-25(2)35(39(48)49)42-37(46)33-23-31(40-34(44)20-17-26-11-5-3-6-12-26)24-43(33)38(47)32(21-27-13-7-4-8-14-27)41-36(45)30-19-18-28-15-9-10-16-29(28)22-30/h3,5-6,9-12,15-16,18-19,22,25,27,31-33,35,48-49H,4,7-8,13-14,17,20-21,23-24H2,1-2H3,(H,40,44)(H,41,45)(H,42,46)/t31-,32+,33-,35-/m0/s1 |
| InChIKey | UIKFNLVBACLPBU-CMCLPRMSSA-N |
| XLogP | 3.78 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|