C37H43N5O7 — CID 146192103
(2S,4S)-1-[3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-N-(4-oxamoyloxan-4-yl)-4-(2-oxo-1-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 146192103) has the molecular formula C37H43N5O7 and a molecular weight of 669.78 g/mol. Its IUPAC name is (2S,4S)-1-[3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-N-(4-oxamoyloxan-4-yl)-4-(2-oxo-1-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-N-(4-oxamoyloxan-4-yl)-4-(2-oxo-1-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146192103 |
| Molecular Formula | C37H43N5O7 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.32 |
| IUPAC Name | (2S,4S)-1-[3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-N-(4-oxamoyloxan-4-yl)-4-(2-oxo-1-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C(=O)C1(NC(=O)[C@@H]2C[C@H](n3ccccc3=O)CN2C(=O)C(CC2CCCCC2)NC(=O)c2ccc3ccccc3c2)CCOCC1 |
| InChI | InChI=1S/C37H43N5O7/c38-33(45)32(44)37(15-18-49-19-16-37)40-35(47)30-22-28(41-17-7-6-12-31(41)43)23-42(30)36(48)29(20-24-8-2-1-3-9-24)39-34(46)27-14-13-25-10-4-5-11-26(25)21-27/h4-7,10-14,17,21,24,28-30H,1-3,8-9,15-16,18-20,22-23H2,(H2,38,45)(H,39,46)(H,40,47)/t28-,29?,30-/m0/s1 |
| InChIKey | MPMDCFHHYNVIFJ-ZLZIOLORSA-N |
| XLogP | 2.63 |
| TPSA | 169.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|