C34H43N7O6 — CID 162478286
(2S,3R,4R)-4-azido-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-3-methoxy-N-(1-oxamoylcyclohexyl)pyrrolidine-2-carboxamide (PubChem CID 162478286) has the molecular formula C34H43N7O6 and a molecular weight of 645.76 g/mol. Its IUPAC name is (2S,3R,4R)-4-azido-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-3-methoxy-N-(1-oxamoylcyclohexyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4R)-4-azido-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-3-methoxy-N-(1-oxamoylcyclohexyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162478286 |
| Molecular Formula | C34H43N7O6 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | (2S,3R,4R)-4-azido-1-[(2R)-3-cyclohexyl-2-(naphthalene-2-carbonylamino)propanoyl]-3-methoxy-N-(1-oxamoylcyclohexyl)pyrrolidine-2-carboxamide |
| SMILES | CO[C@@H]1[C@@H](C(=O)NC2(C(=O)C(N)=O)CCCCC2)N(C(=O)[C@@H](CC2CCCCC2)NC(=O)c2ccc3ccccc3c2)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C34H43N7O6/c1-47-28-26(39-40-36)20-41(27(28)32(45)38-34(29(42)30(35)43)16-8-3-9-17-34)33(46)25(18-21-10-4-2-5-11-21)37-31(44)24-15-14-22-12-6-7-13-23(22)19-24/h6-7,12-15,19,21,25-28H,2-5,8-11,16-18,20H2,1H3,(H2,35,43)(H,37,44)(H,38,45)/t25-,26-,27+,28+/m1/s1 |
| InChIKey | SNAAQCDVDXFATN-VIJSPRBVSA-N |
| XLogP | 3.69 |
| TPSA | 196.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|