C16H21ClN4O — CID 145422975
1-(3-chloro-4-cyanophenyl)-N-[1-(methylamino)ethyl]piperidine-2-carboxamide (PubChem CID 145422975) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-(3-chloro-4-cyanophenyl)-N-[1-(methylamino)ethyl]piperidine-2-carboxamide.
| Compound Name | 1-(3-chloro-4-cyanophenyl)-N-[1-(methylamino)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 145422975 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-(3-chloro-4-cyanophenyl)-N-[1-(methylamino)ethyl]piperidine-2-carboxamide |
| SMILES | CNC(C)NC(=O)C1CCCCN1c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN4O/c1-11(19-2)20-16(22)15-5-3-4-8-21(15)13-7-6-12(10-18)14(17)9-13/h6-7,9,11,15,19H,3-5,8H2,1-2H3,(H,20,22) |
| InChIKey | VXSMHLKSNDANKM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|