C9H16F3N — CID 145423428
(3R)-3-ethyl-1-(1,1,1-trifluoropropan-2-yl)pyrrolidine (PubChem CID 145423428) has the molecular formula C9H16F3N and a molecular weight of 195.23 g/mol. Its IUPAC name is (3R)-3-ethyl-1-(1,1,1-trifluoropropan-2-yl)pyrrolidine.
| Compound Name | (3R)-3-ethyl-1-(1,1,1-trifluoropropan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 145423428 |
| Molecular Formula | C9H16F3N |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | (3R)-3-ethyl-1-(1,1,1-trifluoropropan-2-yl)pyrrolidine |
| SMILES | CC[C@@H]1CCN(C(C)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3N/c1-3-8-4-5-13(6-8)7(2)9(10,11)12/h7-8H,3-6H2,1-2H3/t7?,8-/m1/s1 |
| InChIKey | OTDJVKHIQYKZKN-BRFYHDHCSA-N |
| XLogP | 2.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |