About CID 145425499
CID 145425499 (PubChem CID 145425499) has the molecular formula C6H4B3N5
and a molecular weight of 178.57 g/mol.
Molecular Properties
| Compound Name | CID 145425499 |
| PubChem CID | 145425499 |
| Molecular Formula | C6H4B3N5 |
| Molecular Weight | 178.57 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1nc(N)c2nccn2n1 |
| InChI | InChI=1S/C6H4B3N5/c7-6(8,9)5-12-3(10)4-11-1-2-14(4)13-5/h1-2H,(H2,10,12,13) |
| InChIKey | JFIOBTSWGDRQTA-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.57 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145425499 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145425499?
The IUPAC name of CID 145425499 (CID 145425499) is not available.
What is the SMILES notation for CID 145425499?
The canonical SMILES for CID 145425499 is [B]C([B])([B])c1nc(N)c2nccn2n1.
What is the InChIKey of CID 145425499?
The InChIKey is JFIOBTSWGDRQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4B3N5/c7-6(8,9)5-12-3(10)4-11-1-2-14(4)13-5/h1-2H,(H2,10,12,13).
What are the key properties of CID 145425499?
CID 145425499 has a molecular weight of 178.57 g/mol, XLogP of -1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145425499 is sourced from PubChem (CID 145425499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).