C5H6AlN5 — CID 154474525
8-alumanyl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (PubChem CID 154474525) has the molecular formula C5H6AlN5 and a molecular weight of 163.12 g/mol. Its IUPAC name is 8-alumanyl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine.
| Compound Name | 8-alumanyl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 154474525 |
| Molecular Formula | C5H6AlN5 |
| Molecular Weight | 163.12 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 8-alumanyl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| SMILES | Nc1nc2c([AlH2])nccn2n1 |
| InChI | InChI=1S/C5H4N5.Al.2H/c6-5-8-4-3-7-1-2-10(4)9-5;;;/h1-2H,(H2,6,9);;; |
| InChIKey | WCSRJTDDGHTLHK-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.12 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |