C6H7N5 — CID 155294364
6-methyl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (PubChem CID 155294364) has the molecular formula C6H7N5 and a molecular weight of 149.16 g/mol. Its IUPAC name is 6-methyl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine.
| Compound Name | 6-methyl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 155294364 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 6-methyl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| SMILES | Cc1cn2nc(N)nc2cn1 |
| InChI | InChI=1S/C6H7N5/c1-4-3-11-5(2-8-4)9-6(7)10-11/h2-3H,1H3,(H2,7,10) |
| InChIKey | BGSIUYXLKRGCDO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |