C17H33NO3 — CID 145428993
ethane;ethyl 6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate (PubChem CID 145428993) has the molecular formula C17H33NO3 and a molecular weight of 299.45 g/mol. Its IUPAC name is ethane;ethyl 6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate.
| Compound Name | ethane;ethyl 6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 145428993 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | ethane;ethyl 6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC.CCOC(=O)N1CCC2C(C)(CCC(O)C2(C)C)C1 |
| InChI | InChI=1S/C15H27NO3.C2H6/c1-5-19-13(18)16-9-7-11-14(2,3)12(17)6-8-15(11,4)10-16;1-2/h11-12,17H,5-10H2,1-4H3;1-2H3 |
| InChIKey | OAXNUIYVOQRDIJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |