C21H29N3O3S — CID 145429286
3-(3-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]benzamide (PubChem CID 145429286) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 3-(3-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]benzamide.
| Compound Name | 3-(3-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 145429286 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-(3-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]benzamide |
| SMILES | CC1C=CCN(C(=O)c2cccc(C(=O)NCCCN3CCS(=O)CC3)c2)C1 |
| InChI | InChI=1S/C21H29N3O3S/c1-17-5-3-10-24(16-17)21(26)19-7-2-6-18(15-19)20(25)22-8-4-9-23-11-13-28(27)14-12-23/h2-3,5-7,15,17H,4,8-14,16H2,1H3,(H,22,25) |
| InChIKey | YFXGVAPIBNLFNN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|