C36H19FN4O4 — CID 145429787
18-(4-ethenylphenyl)-7-(4-fluorophenyl)-19-hydroxy-7,11,18,22-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17-trione (PubChem CID 145429787) has the molecular formula C36H19FN4O4 and a molecular weight of 590.57 g/mol. Its IUPAC name is 18-(4-ethenylphenyl)-7-(4-fluorophenyl)-19-hydroxy-7,11,18,22-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17-trione.
| Compound Name | 18-(4-ethenylphenyl)-7-(4-fluorophenyl)-19-hydroxy-7,11,18,22-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17-trione |
|---|---|
| PubChem CID | 145429787 |
| Molecular Formula | C36H19FN4O4 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | 18-(4-ethenylphenyl)-7-(4-fluorophenyl)-19-hydroxy-7,11,18,22-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17-trione |
| SMILES | C=Cc1ccc(N2C(=O)c3ccc4c5ncc6c7c(ccc(c8ncc(c3c48)C2O)c75)C(=O)N(c2ccc(F)cc2)C6=O)cc1 |
| InChI | InChI=1S/C36H19FN4O4/c1-2-17-3-7-19(8-4-17)40-33(42)23-13-11-21-29-27(23)25(35(40)44)15-38-31(29)22-12-14-24-28-26(16-39-32(21)30(22)28)36(45)41(34(24)43)20-9-5-18(37)6-10-20/h2-16,35,44H,1H2 |
| InChIKey | COCDGTJXCVBRRR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|