C32H41N7O — CID 145432749
N-[C-butyl-N-(1-methylcyclopentyl)carbonimidoyl]-N-[[4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]-5-(5-methyl-3-pyridinyl)phenyl]phenyl]methyl]formamide (PubChem CID 145432749) has the molecular formula C32H41N7O and a molecular weight of 539.73 g/mol. Its IUPAC name is N-[C-butyl-N-(1-methylcyclopentyl)carbonimidoyl]-N-[[4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]-5-(5-methyl-3-pyridinyl)phenyl]phenyl]methyl]formamide.
| Compound Name | N-[C-butyl-N-(1-methylcyclopentyl)carbonimidoyl]-N-[[4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]-5-(5-methyl-3-pyridinyl)phenyl]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 145432749 |
| Molecular Formula | C32H41N7O |
| Molecular Weight | 539.73 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | N-[C-butyl-N-(1-methylcyclopentyl)carbonimidoyl]-N-[[4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]-5-(5-methyl-3-pyridinyl)phenyl]phenyl]methyl]formamide |
| SMILES | CCCC/C(=N\C1(C)CCCC1)N(C=O)Cc1ccc(-c2cc(-c3cncc(C)c3)ccc2/C(N)=N/NN)cc1 |
| InChI | InChI=1S/C32H41N7O/c1-4-5-8-30(36-32(3)15-6-7-16-32)39(22-40)21-24-9-11-25(12-10-24)29-18-26(27-17-23(2)19-35-20-27)13-14-28(29)31(33)37-38-34/h9-14,17-20,22,38H,4-8,15-16,21,34H2,1-3H3,(H2,33,37)/b36-30+ |
| InChIKey | BNCPWUCMLZBQIN-FMIFUCRQSA-N |
| XLogP | 5.69 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.73 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|