C25H34N6O2 — CID 145436223
ethanimidoyl 2-[[1-butan-2-yl-5-(2-ethoxy-3-pyridinyl)-2-ethyl-3-methylpyrrolo[3,2-b]pyridin-7-yl]amino]ethanimidate (PubChem CID 145436223) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is ethanimidoyl 2-[[1-butan-2-yl-5-(2-ethoxy-3-pyridinyl)-2-ethyl-3-methylpyrrolo[3,2-b]pyridin-7-yl]amino]ethanimidate.
| Compound Name | ethanimidoyl 2-[[1-butan-2-yl-5-(2-ethoxy-3-pyridinyl)-2-ethyl-3-methylpyrrolo[3,2-b]pyridin-7-yl]amino]ethanimidate |
|---|---|
| PubChem CID | 145436223 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | ethanimidoyl 2-[[1-butan-2-yl-5-(2-ethoxy-3-pyridinyl)-2-ethyl-3-methylpyrrolo[3,2-b]pyridin-7-yl]amino]ethanimidate |
| SMILES | [H]/N=C(/CNc1cc(-c2cccnc2OCC)nc2c(C)c(CC)n(C(C)CC)c12)O/C(C)=N/[H] |
| InChI | InChI=1S/C25H34N6O2/c1-7-15(4)31-21(8-2)16(5)23-24(31)20(29-14-22(27)33-17(6)26)13-19(30-23)18-11-10-12-28-25(18)32-9-3/h10-13,15,26-27H,7-9,14H2,1-6H3,(H,29,30)/b26-17+,27-22- |
| InChIKey | YAMGRHAKKVEQHC-FDNRVBQMSA-N |
| XLogP | 5.74 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|