C21H28N8O — CID 138746762
N-(1-aminoethylidene)-2-[[5-(2-ethoxy-3-pyridinyl)-3-methyl-1-propan-2-ylpyrazolo[4,5-b]pyridin-7-yl]amino]ethanimidamide (PubChem CID 138746762) has the molecular formula C21H28N8O and a molecular weight of 408.51 g/mol. Its IUPAC name is N-(1-aminoethylidene)-2-[[5-(2-ethoxy-3-pyridinyl)-3-methyl-1-propan-2-ylpyrazolo[4,5-b]pyridin-7-yl]amino]ethanimidamide.
| Compound Name | N-(1-aminoethylidene)-2-[[5-(2-ethoxy-3-pyridinyl)-3-methyl-1-propan-2-ylpyrazolo[4,5-b]pyridin-7-yl]amino]ethanimidamide |
|---|---|
| PubChem CID | 138746762 |
| Molecular Formula | C21H28N8O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-(1-aminoethylidene)-2-[[5-(2-ethoxy-3-pyridinyl)-3-methyl-1-propan-2-ylpyrazolo[4,5-b]pyridin-7-yl]amino]ethanimidamide |
| SMILES | [H]/N=C(CNc1cc(-c2cccnc2OCC)nc2c(C)nn(C(C)C)c12)\N=C(/C)N |
| InChI | InChI=1S/C21H28N8O/c1-6-30-21-15(8-7-9-24-21)16-10-17(25-11-18(23)26-14(5)22)20-19(27-16)13(4)28-29(20)12(2)3/h7-10,12H,6,11H2,1-5H3,(H,25,27)(H3,22,23,26) |
| InChIKey | XSJCEYKTVBIFKU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|