C24H30N6O2 — CID 166594432
ethyl (2Z)-2-[7-[(2-methoxy-3-pyridinyl)methylamino]-3-methyl-1-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl]penta-2,4-dienimidate (PubChem CID 166594432) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is ethyl (2Z)-2-[7-[(2-methoxy-3-pyridinyl)methylamino]-3-methyl-1-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl]penta-2,4-dienimidate.
| Compound Name | ethyl (2Z)-2-[7-[(2-methoxy-3-pyridinyl)methylamino]-3-methyl-1-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl]penta-2,4-dienimidate |
|---|---|
| PubChem CID | 166594432 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | ethyl (2Z)-2-[7-[(2-methoxy-3-pyridinyl)methylamino]-3-methyl-1-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl]penta-2,4-dienimidate |
| SMILES | [H]/N=C(OCC)/C(=C\C=C)c1cc(NCc2cccnc2OC)c2c(n1)c(C)nn2C(C)C |
| InChI | InChI=1S/C24H30N6O2/c1-7-10-18(23(25)32-8-2)19-13-20(27-14-17-11-9-12-26-24(17)31-6)22-21(28-19)16(5)29-30(22)15(3)4/h7,9-13,15,25H,1,8,14H2,2-6H3,(H,27,28)/b18-10-,25-23- |
| InChIKey | XJADPOFFELMXTA-YEBGITAWSA-N |
| XLogP | 4.92 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|