C17H24O4 — CID 14543713
(5,6-diformyl-1,1,4a-trimethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-yl) acetate (PubChem CID 14543713) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (5,6-diformyl-1,1,4a-trimethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-yl) acetate.
| Compound Name | (5,6-diformyl-1,1,4a-trimethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-yl) acetate |
|---|---|
| PubChem CID | 14543713 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (5,6-diformyl-1,1,4a-trimethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(C=O)C(C=O)=CCC2C1(C)C |
| InChI | InChI=1S/C17H24O4/c1-11(20)21-15-7-8-17(4)13(10-19)12(9-18)5-6-14(17)16(15,2)3/h5,9-10,13-15H,6-8H2,1-4H3 |
| InChIKey | LWRNXEVCYOKYID-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|