C21H32O2 — CID 145439265
(17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-diol (PubChem CID 145439265) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 145439265 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-diol |
| SMILES | C/C=C1/CCC2C3CC=C4CC(O)CCC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C21H32O2/c1-4-13-6-8-17-16-7-5-14-11-15(22)9-10-20(14,2)19(16)18(23)12-21(13,17)3/h4-5,15-19,22-23H,6-12H2,1-3H3/b13-4- |
| InChIKey | RGDIBJAZBIMJTD-PQMHYQBVSA-N |
| XLogP | 4.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|