C23H36O2 — CID 155129441
(3S,8S,9S,10R,11R,13S,14S,17Z)-3-ethyl-17-ethylidene-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol (PubChem CID 155129441) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (3S,8S,9S,10R,11R,13S,14S,17Z)-3-ethyl-17-ethylidene-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (3S,8S,9S,10R,11R,13S,14S,17Z)-3-ethyl-17-ethylidene-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 155129441 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (3S,8S,9S,10R,11R,13S,14S,17Z)-3-ethyl-17-ethylidene-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
| SMILES | C/C=C1/CC[C@H]2[C@@H]3CC=C4C[C@](O)(CC)CC[C@]4(C)[C@H]3[C@H](O)C[C@]12C |
| InChI | InChI=1S/C23H36O2/c1-5-15-8-10-18-17-9-7-16-13-23(25,6-2)12-11-21(16,3)20(17)19(24)14-22(15,18)4/h5,7,17-20,24-25H,6,8-14H2,1-4H3/b15-5-/t17-,18-,19+,20+,21-,22+,23-/m0/s1 |
| InChIKey | WBQSFVBFBSRCDO-GVFDVBLFSA-N |
| XLogP | 5.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|