C27H44O2 — CID 145439268
(3S,17S)-17-(5,5-dimethylhexyl)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 145439268) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (3S,17S)-17-(5,5-dimethylhexyl)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | (3S,17S)-17-(5,5-dimethylhexyl)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 145439268 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (3S,17S)-17-(5,5-dimethylhexyl)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CC(C)(C)CCCC[C@H]1CCC2C3CC=C4C[C@@H](O)CCC4(C)C3C(=O)CC21C |
| InChI | InChI=1S/C27H44O2/c1-25(2,3)14-7-6-8-18-10-12-22-21-11-9-19-16-20(28)13-15-26(19,4)24(21)23(29)17-27(18,22)5/h9,18,20-22,24,28H,6-8,10-17H2,1-5H3/t18-,20-,21?,22?,24?,26?,27?/m0/s1 |
| InChIKey | NQUIISUBSSFHAZ-FGELYGGXSA-N |
| XLogP | 6.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|