C36H53N5O4 — CID 145439359
tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]-N-methylcarbamate;propane (PubChem CID 145439359) has the molecular formula C36H53N5O4 and a molecular weight of 619.85 g/mol. Its IUPAC name is tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]-N-methylcarbamate;propane.
| Compound Name | tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]-N-methylcarbamate;propane |
|---|---|
| PubChem CID | 145439359 |
| Molecular Formula | C36H53N5O4 |
| Molecular Weight | 619.85 g/mol |
| Exact Mass | 619.41 |
| IUPAC Name | tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]-N-methylcarbamate;propane |
| SMILES | CCC.CCCCc1nc2c(NCc3ccc(OC)cc3OC)nc3ccccc3c2n1CCCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H45N5O4.C3H8/c1-8-9-16-28-36-29-30(38(28)20-13-12-19-37(5)32(39)42-33(2,3)4)25-14-10-11-15-26(25)35-31(29)34-22-23-17-18-24(40-6)21-27(23)41-7;1-3-2/h10-11,14-15,17-18,21H,8-9,12-13,16,19-20,22H2,1-7H3,(H,34,35);3H2,1-2H3 |
| InChIKey | MOMXPYUBRRCRTO-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.85 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|