C19H22F2N6O3 — CID 145440353
(6S)-N-(2,6-difluoro-4-pyridinyl)-6-methyl-3-[(4S)-4,5,5-trimethyl-2-oxo-1,3-oxazolidin-3-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide (PubChem CID 145440353) has the molecular formula C19H22F2N6O3 and a molecular weight of 420.42 g/mol. Its IUPAC name is (6S)-N-(2,6-difluoro-4-pyridinyl)-6-methyl-3-[(4S)-4,5,5-trimethyl-2-oxo-1,3-oxazolidin-3-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide.
| Compound Name | (6S)-N-(2,6-difluoro-4-pyridinyl)-6-methyl-3-[(4S)-4,5,5-trimethyl-2-oxo-1,3-oxazolidin-3-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 145440353 |
| Molecular Formula | C19H22F2N6O3 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (6S)-N-(2,6-difluoro-4-pyridinyl)-6-methyl-3-[(4S)-4,5,5-trimethyl-2-oxo-1,3-oxazolidin-3-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
| SMILES | C[C@@H]1N(c2cnn3c2CN(C(=O)Nc2cc(F)nc(F)c2)[C@@H](C)C3)C(=O)OC1(C)C |
| InChI | InChI=1S/C19H22F2N6O3/c1-10-8-26-14(13(7-22-26)27-11(2)19(3,4)30-18(27)29)9-25(10)17(28)23-12-5-15(20)24-16(21)6-12/h5-7,10-11H,8-9H2,1-4H3,(H,23,24,28)/t10-,11-/m0/s1 |
| InChIKey | KDOLKLXRKGOSHM-QWRGUYRKSA-N |
| XLogP | 3.12 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|