C17H31NO — CID 145441255
2-[[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-methylamino]methyl]-2-ethylpentan-1-ol (PubChem CID 145441255) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 2-[[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-methylamino]methyl]-2-ethylpentan-1-ol.
| Compound Name | 2-[[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-methylamino]methyl]-2-ethylpentan-1-ol |
|---|---|
| PubChem CID | 145441255 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 2-[[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-methylamino]methyl]-2-ethylpentan-1-ol |
| SMILES | C=C/C(=C\C=C/C)CN(C)CC(CC)(CO)CCC |
| InChI | InChI=1S/C17H31NO/c1-6-10-11-16(8-3)13-18(5)14-17(9-4,15-19)12-7-2/h6,8,10-11,19H,3,7,9,12-15H2,1-2,4-5H3/b10-6-,16-11+ |
| InChIKey | NRLQHPWWIFHHRR-AXLPOJBWSA-N |
| XLogP | 3.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|