C14H23NO — CID 145440061
[1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-methylpiperidin-4-yl]methanol (PubChem CID 145440061) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is [1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-methylpiperidin-4-yl]methanol.
| Compound Name | [1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-methylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 145440061 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | [1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-methylpiperidin-4-yl]methanol |
| SMILES | C=C/C=C(\C=C)CN1CCC(C)(CO)CC1 |
| InChI | InChI=1S/C14H23NO/c1-4-6-13(5-2)11-15-9-7-14(3,12-16)8-10-15/h4-6,16H,1-2,7-12H2,3H3/b13-6+ |
| InChIKey | UHCAWXFLVLCSQC-AWNIVKPZSA-N |
| XLogP | 2.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|