C16H31NO — CID 144671472
ethane;ethanol;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidine (PubChem CID 144671472) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;ethanol;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidine.
| Compound Name | ethane;ethanol;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidine |
|---|---|
| PubChem CID | 144671472 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | ethane;ethanol;1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidine |
| SMILES | C=C/C=C(\C=C)CN1CCCCC1.CC.CCO |
| InChI | InChI=1S/C12H19N.C2H6O.C2H6/c1-3-8-12(4-2)11-13-9-6-5-7-10-13;1-2-3;1-2/h3-4,8H,1-2,5-7,9-11H2;3H,2H2,1H3;1-2H3/b12-8+;; |
| InChIKey | FGAVAKYFJMVPQE-BPWZRWDXSA-N |
| XLogP | 3.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|