C12H19NO — CID 143150891
1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-ol (PubChem CID 143150891) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-ol.
| Compound Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 143150891 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-ol |
| SMILES | C=C/C=C(\C=C)CN1CCC(O)CC1 |
| InChI | InChI=1S/C12H19NO/c1-3-5-11(4-2)10-13-8-6-12(14)7-9-13/h3-5,12,14H,1-2,6-10H2/b11-5+ |
| InChIKey | NGNZWPVGKUXFKF-VZUCSPMQSA-N |
| XLogP | 1.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|