C13H21NO — CID 143718323
1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]piperidin-4-ol (PubChem CID 143718323) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]piperidin-4-ol.
| Compound Name | 1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 143718323 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]piperidin-4-ol |
| SMILES | C=C(/C=C\C=C/C)CN1CCC(O)CC1 |
| InChI | InChI=1S/C13H21NO/c1-3-4-5-6-12(2)11-14-9-7-13(15)8-10-14/h3-6,13,15H,2,7-11H2,1H3/b4-3-,6-5- |
| InChIKey | GUYBESWIRXOJDU-OUPQRBNQSA-N |
| XLogP | 2.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|