C12H22FNO — CID 122366113
1-[(Z)-2-fluoro-4,4-dimethylpent-2-enyl]piperidin-4-ol (PubChem CID 122366113) has the molecular formula C12H22FNO and a molecular weight of 215.31 g/mol. Its IUPAC name is 1-[(Z)-2-fluoro-4,4-dimethylpent-2-enyl]piperidin-4-ol.
| Compound Name | 1-[(Z)-2-fluoro-4,4-dimethylpent-2-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 122366113 |
| Molecular Formula | C12H22FNO |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-[(Z)-2-fluoro-4,4-dimethylpent-2-enyl]piperidin-4-ol |
| SMILES | CC(C)(C)/C=C(\F)CN1CCC(O)CC1 |
| InChI | InChI=1S/C12H22FNO/c1-12(2,3)8-10(13)9-14-6-4-11(15)5-7-14/h8,11,15H,4-7,9H2,1-3H3/b10-8- |
| InChIKey | KFHGIEXGNYCBAV-NTMALXAHSA-N |
| XLogP | 2.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |