C13H23NO — CID 163860284
1-[(E)-2-ethenyl-4-methylpent-2-enyl]piperidin-4-ol (PubChem CID 163860284) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-[(E)-2-ethenyl-4-methylpent-2-enyl]piperidin-4-ol.
| Compound Name | 1-[(E)-2-ethenyl-4-methylpent-2-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 163860284 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-[(E)-2-ethenyl-4-methylpent-2-enyl]piperidin-4-ol |
| SMILES | C=C/C(=C\C(C)C)CN1CCC(O)CC1 |
| InChI | InChI=1S/C13H23NO/c1-4-12(9-11(2)3)10-14-7-5-13(15)6-8-14/h4,9,11,13,15H,1,5-8,10H2,2-3H3/b12-9+ |
| InChIKey | PBXAKSQLFPRYGS-FMIVXFBMSA-N |
| XLogP | 2.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|