C12H21NO — CID 143491900
1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidin-4-ol (PubChem CID 143491900) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidin-4-ol.
| Compound Name | 1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 143491900 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidin-4-ol |
| SMILES | C/C=C\C(=C/C)CN1CCC(O)CC1 |
| InChI | InChI=1S/C12H21NO/c1-3-5-11(4-2)10-13-8-6-12(14)7-9-13/h3-5,12,14H,6-10H2,1-2H3/b5-3-,11-4+ |
| InChIKey | ATBKYAIATZWLRW-DVJFJSKXSA-N |
| XLogP | 1.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|