C18H31NO — CID 143533081
ethane;[4-methyl-1-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]piperidin-4-yl]methanol (PubChem CID 143533081) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is ethane;[4-methyl-1-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]piperidin-4-yl]methanol.
| Compound Name | ethane;[4-methyl-1-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 143533081 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | ethane;[4-methyl-1-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]piperidin-4-yl]methanol |
| SMILES | C=C/C=C\C(=C/C=C)CN1CCC(C)(CO)CC1.CC |
| InChI | InChI=1S/C16H25NO.C2H6/c1-4-6-8-15(7-5-2)13-17-11-9-16(3,14-18)10-12-17;1-2/h4-8,18H,1-2,9-14H2,3H3;1-2H3/b8-6-,15-7+; |
| InChIKey | QTILIPSHKVSFKV-MMWRLFOHSA-N |
| XLogP | 3.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|