C15H25NO — CID 91098845
2-(3-hexa-2,4-dien-3-yl-1-methyl-4,7-dihydro-2H-azepin-3-yl)ethanol (PubChem CID 91098845) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(3-hexa-2,4-dien-3-yl-1-methyl-4,7-dihydro-2H-azepin-3-yl)ethanol.
| Compound Name | 2-(3-hexa-2,4-dien-3-yl-1-methyl-4,7-dihydro-2H-azepin-3-yl)ethanol |
|---|---|
| PubChem CID | 91098845 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-(3-hexa-2,4-dien-3-yl-1-methyl-4,7-dihydro-2H-azepin-3-yl)ethanol |
| SMILES | CC=CC(=CC)C1(CCO)CC=CCN(C)C1 |
| InChI | InChI=1S/C15H25NO/c1-4-8-14(5-2)15(10-12-17)9-6-7-11-16(3)13-15/h4-8,17H,9-13H2,1-3H3 |
| InChIKey | UDYHWZBVWQEKOY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|