C17H24O3 — CID 14544163
7-methyl-9-phenylmethoxynon-4-yne-1,7-diol (PubChem CID 14544163) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 7-methyl-9-phenylmethoxynon-4-yne-1,7-diol.
| Compound Name | 7-methyl-9-phenylmethoxynon-4-yne-1,7-diol |
|---|---|
| PubChem CID | 14544163 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 7-methyl-9-phenylmethoxynon-4-yne-1,7-diol |
| SMILES | CC(O)(CC#CCCCO)CCOCc1ccccc1 |
| InChI | InChI=1S/C17H24O3/c1-17(19,11-7-2-3-8-13-18)12-14-20-15-16-9-5-4-6-10-16/h4-6,9-10,18-19H,3,8,11-15H2,1H3 |
| InChIKey | BVCOKRMIFFFFKN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|