C13H17NO2 — CID 53474082
2,2-dideuterio-3-hydroxy-5-phenylmethoxy-3-(trideuteriomethyl)pentanenitrile (PubChem CID 53474082) has the molecular formula C13H17NO2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2,2-dideuterio-3-hydroxy-5-phenylmethoxy-3-(trideuteriomethyl)pentanenitrile.
| Compound Name | 2,2-dideuterio-3-hydroxy-5-phenylmethoxy-3-(trideuteriomethyl)pentanenitrile |
|---|---|
| PubChem CID | 53474082 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,2-dideuterio-3-hydroxy-5-phenylmethoxy-3-(trideuteriomethyl)pentanenitrile |
| SMILES | [2H]C([2H])([2H])C(O)(CCOCc1ccccc1)C([2H])([2H])C#N |
| InChI | InChI=1S/C13H17NO2/c1-13(15,7-9-14)8-10-16-11-12-5-3-2-4-6-12/h2-6,15H,7-8,10-11H2,1H3/i1D3,7D2 |
| InChIKey | KLBWOVMAOFLOGU-WRMAMSRYSA-N |
| XLogP | 2.26 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|