C26H23ClN2S — CID 145442336
2-chloro-4-dibenzothiophen-2-yl-7-methyl-8-[(Z)-prop-1-enyl]quinazoline;ethane (PubChem CID 145442336) has the molecular formula C26H23ClN2S and a molecular weight of 431.00 g/mol. Its IUPAC name is 2-chloro-4-dibenzothiophen-2-yl-7-methyl-8-[(Z)-prop-1-enyl]quinazoline;ethane.
| Compound Name | 2-chloro-4-dibenzothiophen-2-yl-7-methyl-8-[(Z)-prop-1-enyl]quinazoline;ethane |
|---|---|
| PubChem CID | 145442336 |
| Molecular Formula | C26H23ClN2S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-chloro-4-dibenzothiophen-2-yl-7-methyl-8-[(Z)-prop-1-enyl]quinazoline;ethane |
| SMILES | C/C=C\c1c(C)ccc2c(-c3ccc4sc5ccccc5c4c3)nc(Cl)nc12.CC |
| InChI | InChI=1S/C24H17ClN2S.C2H6/c1-3-6-16-14(2)9-11-18-22(26-24(25)27-23(16)18)15-10-12-21-19(13-15)17-7-4-5-8-20(17)28-21;1-2/h3-13H,1-2H3;1-2H3/b6-3-; |
| InChIKey | PNHVIFCZBLTZLZ-AQPBACSKSA-N |
| XLogP | 8.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |